* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1H-INDENE, 5-FLUORO-1-METHYL-, (1S)- |
CAS: | 170941-14-7 |
English Synonyms: | 1H-INDENE, 5-FLUORO-1-METHYL-, (1S)- |
MDL Number.: | MFCD18831014 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C[C@H]1C=Cc2c1ccc(c2)F |
InChi: | InChI=1S/C10H9F/c1-7-2-3-8-6-9(11)4-5-10(7)8/h2-7H,1H3/t7-/m0/s1 |
InChiKey: | InChIKey=ZWDJNGVEZDTETR-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.