* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHIOL |
| CAS: | 17162-32-2 |
| English Synonyms: | XANTHIOL |
| MDL Number.: | MFCD01702190 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)C(c3cc(ccc3S2)Cl)CCCN4CCN(CC4)CCCO.Cl.Cl |
| InChi: | InChI=1S/C23H29ClN2OS.2ClH/c24-18-8-9-23-21(17-18)19(20-5-1-2-7-22(20)28-23)6-3-10-25-12-14-26(15-13-25)11-4-16-27;;/h1-2,5,7-9,17,19,27H,3-4,6,10-16H2;2*1H |
| InChiKey: | InChIKey=WCSMSWYAHBNGDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.