* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PHE-GLY-NH2 |
CAS: | 17187-05-2 |
English Synonyms: | Z-PHE-GLY-NH2 |
MDL Number.: | MFCD00238496 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)NCC(=O)N)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C19H21N3O4/c20-17(23)12-21-18(24)16(11-14-7-3-1-4-8-14)22-19(25)26-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H2,20,23)(H,21,24)(H,22,25)/t16-/m0/s1 |
InChiKey: | InChIKey=HAXZMQQYSRGDTM-INIZCTEOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.