* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-OCTANE-D18 |
CAS: | 17252-77-6 |
English Synonyms: | OCTANE-D18 ; N-OCTANE-D18 ; OCTANE-D18 |
MDL Number.: | MFCD00037626 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
InChiKey: | InChIKey=null |
Property |
|
Melting Point: | -57°C |
Boiling Point: | MP: -57 DEG C/125-127 °C |
Density: | 0.815g/mLat25°C(lit.) |
Physical Property: | FLASHPOINT: 16 DEG C FLASHPOINT: 60.8 DEG F REFRACTIVE INDEX: N20/D 1.394(LIT) |
Comments: | MASS SHIFT: M+18 RIDADR: UN 1262 3/PG 2 UNSPSC: 12142200 WGK: 3 |
Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 132.38 |
Safety information |
|
Symbol: | GHS02 GHS07 GHS08 GHS09 |
Signal word: | Danger |
Hazard statements: | H225-H304-H315-H336-H371-H400 |
Precautionary statements: | P210-P260-P273-P301 + P310-P331 |
hazard symbol: | F,Xn,N |
Risk Code: | R:11-38-50/53-65-67 |
Safe Code: | S:9-16-29-33-60-61-62 |
UN Code: | 1262 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.