* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RENYTOLINE |
CAS: | 1729-61-9 |
English Synonyms: | RENYTOLINE |
MDL Number.: | MFCD00866107 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)-c3ccccc3C2=Cc4ccc(cc4)C(=N)N |
InChi: | InChI=1S/C21H16N2/c22-21(23)15-11-9-14(10-12-15)13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-13H,(H3,22,23) |
InChiKey: | InChIKey=WOVTUUKKGNHVFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.