* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-Methyl-[1,1'-biphenyl]-3-amine |
CAS: | 172975-98-3 |
English Synonyms: | 2-METHYL-[1,1'-BIPHENYL]-3-AMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1=C(C=CC=C1N)C1=CC=CC=C1 |
InChi: | InChI=1S/C13H13N/c1-10-12(8-5-9-13(10)14)11-6-3-2-4-7-11/h2-9H,14H2,1H3 |
InChiKey: | InChIKey=WXVGZIZBMFJASZ-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.