* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GONIOTHALAMIN |
| CAS: | 17303-67-2 |
| English Synonyms: | GONIOTHALAMIN |
| MDL Number.: | MFCD01694033 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)/C=C/[C@@H]2CC=CC(=O)O2 |
| InChi: | InChI=1S/C13H12O2/c14-13-8-4-7-12(15-13)10-9-11-5-2-1-3-6-11/h1-6,8-10,12H,7H2/b10-9+/t12-/m0/s1 |
| InChiKey: | InChIKey=RLGHFVLWYYVMQZ-VMPCVLLUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.