* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzyl 2-azidoacetate |
CAS: | 173601-46-2 |
English Synonyms: | BENZYL 2-AZIDOACETATE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CC(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C9H9N3O2/c10-12-11-6-9(13)14-7-8-4-2-1-3-5-8/h1-5H,6-7H2 |
InChiKey: | InChIKey=FFHGCXRBGUYALU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.