* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-AMINO-4-PHENYL-2H-1,2,4-TRIAZOL-3(4H)-ONE |
CAS: | 1739-21-5 |
English Synonyms: | 5-AMINO-4-PHENYL-2H-1,2,4-TRIAZOL-3(4H)-ONE |
MDL Number.: | MFCD18911033 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)n2c(n[nH]c2=O)N |
InChi: | InChI=1S/C8H8N4O/c9-7-10-11-8(13)12(7)6-4-2-1-3-5-6/h1-5H,(H2,9,10)(H,11,13) |
InChiKey: | InChIKey=BRDCQCQXORUFQS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.