* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-OXA-6-THIASPIRO[3.3]HEPTANE |
CAS: | 174-80-1 |
English Synonyms: | 2-OXA-6-THIASPIRO[3.3]HEPTANE |
MDL Number.: | MFCD17170021 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1C2(CO1)CSC2 |
InChi: | InChI=1S/C5H8OS/c1-5(2-6-1)3-7-4-5/h1-4H2 |
InChiKey: | InChIKey=SNUILXWRUPARSS-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.