Molecular Structure:
CAS No.:
174635-69-9
Product Name.:
CCD No.:CCD00180663
Formula:C26 H24 N2 O
MolWeight:380.489
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(9)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(5)
|
|
| Product Name： | SB 222200 |
| CAS： | 174635-69-9 |
| English Synonyms： | (S)-3-METHYL-2-PHENYL-N-(1-PHENYLPROPYL)-4-QUINOLINECARBOXAMIDE ; SB 222200 ; SB-222200 |
| MDL Number.： | MFCD00944072 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CC[C@@H](c1ccccc1)NC(=O)c2c(c(nc3c2cccc3)c4ccccc4)C |
| InChi： | InChI=1S/C26H24N2O/c1-3-22(19-12-6-4-7-13-19)28-26(29)24-18(2)25(20-14-8-5-9-15-20)27-23-17-11-10-16-21(23)24/h4-17,22H,3H2,1-2H3,(H,28,29)/t22-/m0/s1 |
| InChiKey： | InChIKey=MQNYRKWJSMQECI-QFIPXVFZSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
