* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IMIDAZO[1,2-A]PYRIDINE-5-ETHANOL |
| CAS: | 175143-83-6 |
| English Synonyms: | IMIDAZO[1,2-A]PYRIDINE-5-ETHANOL |
| MDL Number.: | MFCD13183177 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(n2ccnc2c1)CCO |
| InChi: | InChI=1S/C9H10N2O/c12-7-4-8-2-1-3-9-10-5-6-11(8)9/h1-3,5-6,12H,4,7H2 |
| InChiKey: | InChIKey=FRBXLEMUWUFWIX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.