* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 3,5-DIBROMOBENZAMIDE |
| CAS: | 175205-85-3 |
| EnglishSynonyms: | 3,5-DIBROMOBENZAMIDE |
| pro_mdlNumber: | MFCD00178771 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | c1c(cc(cc1Br)Br)C(=O)N |
| InChi: | InChI=1S/C7H5Br2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| InChiKey: | InChIKey=IOFGMNBDIDEBIQ-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 187-191 DEG C |
| Comments: | RIDADR: UN 2811 6.1/PG 3 UNSPSC: 12352100 WGK: 3 |
|
|
| secure_symbol: |
GHS06
|
| secure_signal_word: | Danger |
| secure_risk_stmt: | H301-H319 |
| secure_cautionary_stmt: | P301 + P310-P305 + P351 + P338 |
| secure_damage_code: | Xn |
| secure_risk_disclosure_stmt: | R:22 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.