Molecular Structure:
CAS No.:
17540-75-9
Product Name.:
CCD No.:CCD00047957
Formula:C18 H30 O
MolWeight:262.434
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(8)
- Buyers(0)
- Spectrum(0)
- MSDS(1)
- Price(3)
|
|
| Product Name： | 4-SEC-BUTYL-2,6-DI-TERT-BUTYLPHENOL |
| CAS： | 17540-75-9 |
| English Synonyms： | 4-SEC-BUTYL-2,6-DI-TERT-BUTYLPHENOL |
| MDL Number.： | MFCD00075575 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | CCC(C)c1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C |
| InChi： | InChI=1S/C18H30O/c1-9-12(2)13-10-14(17(3,4)5)16(19)15(11-13)18(6,7)8/h10-12,19H,9H2,1-8H3 |
| InChiKey： | InChIKey=BFZOTKYPSZSDEV-UHFFFAOYSA-N |
|
|
| Melting Point： | 25 DEG C(LIT) |
| Boiling Point： | 141-142 DEG C/10 MMHG(LIT) |
| Density： | 0.902g/mLat25°C(lit.) |
| Physical Property： | FLASHPOINT: 113 DEG C FLASHPOINT: 235.4 DEG F |
| Comments： | UNSPSC: 12352100 WGK: 3 |
|
|
| Symbol： |
GHS07
|
| Signal word： | Warning |
| Hazard statements： | H315-H319-H335 |
| Precautionary statements： | P261-P305 + P351 + P338 |
| hazard symbol： | Xi |
| Risk Code： | R:36/37/38 |
| Safe Code： | S:26-37/39 |
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
