* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-DIHYDROBENZO(A)PYRENE |
CAS: | 17573-15-8 |
English Synonyms: | 9,10-DIHYDROBENZO(A)PYRENE |
MDL Number.: | MFCD01662890 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1cc2ccc3cc4c(c5c3c2c(c1)cc5)CCC=C4 |
InChi: | InChI=1S/C20H14/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1,3-6,8-12H,2,7H2 |
InChiKey: | InChIKey=CRWVCBYUFDAUHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.