* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3'-HYDROXYISOSAFROLE |
CAS: | 17581-86-1 |
English Synonyms: | 3'-HYDROXYISOSAFROLE ; (2E)-3-(1,3-BENZODIOXOL-5-YL)-2-PROPEN-1-OL |
MDL Number.: | MFCD01696250 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1/C=C/CO)OCO2 |
InChi: | InChI=1S/C10H10O3/c11-5-1-2-8-3-4-9-10(6-8)13-7-12-9/h1-4,6,11H,5,7H2/b2-1+ |
InChiKey: | InChIKey=JQZASRHQYJJUCE-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.