* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PH 800/20 |
CAS: | 176-02-3 |
English Synonyms: | 2,3,7,8-TETRATHIASPIRO[4.4]NONANE ; PH 800/20 |
MDL Number.: | MFCD01682645 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1C2(CSS1)CSSC2 |
InChi: | InChI=1S/C5H8S4/c1-5(2-7-6-1)3-8-9-4-5/h1-4H2 |
InChiKey: | InChIKey=FVXQRBBSEYXNFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.