* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE COBALT(II) |
CAS: | 17632-19-8 |
English Synonyms: | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE COBALT(II) ; [CO(OEP)] ; 2,3,7,8,12,13,17,18-OCTAETHYLPORPHYRINATO COBALT(II) |
MDL Number.: | MFCD00012148 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCc1/c/2c/c3n/c(c\c4c(c(c/5n4[Co]n2/c(/c1CC)c\c6n/c(c5)/C(=C6CC)CC)CC)CC)/C(=C3CC)CC |
InChi: | InChI=1S/C36H44N4.Co/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-; |
InChiKey: | InChIKey=CILRATIHXSICFS-XTPDIVBZSA-N |
Property |
|
Comments: | UNSPSC: 12171500 UV ABSORPTION: LAMBDAMAX 393 NM WGK: 3 |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.