* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-HYDROXY-1-NITROPYRENE |
CAS: | 1767-28-8 |
English Synonyms: | 6-HYDROXY-1-NITROPYRENE |
MDL Number.: | MFCD01692926 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc2c(ccc3c2c4c1ccc(c4cc3)O)[N+](=O)[O-] |
InChi: | InChI=1S/C16H9NO3/c18-14-8-4-10-1-5-11-13(17(19)20)7-3-9-2-6-12(14)16(10)15(9)11/h1-8,18H |
InChiKey: | InChIKey=MAVZUIFIVMZYMX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.