* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-PRO-MET-OH |
| CAS: | 17730-18-6 |
| English Synonyms: | Z-L-PROLYL-L-METHIONINE ; Z-PRO-MET-OH |
| MDL Number.: | MFCD00020824 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CSCC[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C18H24N2O5S/c1-26-11-9-14(17(22)23)19-16(21)15-8-5-10-20(15)18(24)25-12-13-6-3-2-4-7-13/h2-4,6-7,14-15H,5,8-12H2,1H3,(H,19,21)(H,22,23)/t14-,15-/m0/s1 |
| InChiKey: | InChIKey=QHSSZNCPOQRYPJ-GJZGRUSLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.