* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BROMO-1H-BENZIMIDAZOL-5-AMINE |
| CAS: | 177843-73-1 |
| English Synonyms: | 7-BROMO-1H-BENZIMIDAZOL-5-AMINE |
| MDL Number.: | MFCD17012748 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1c(cc(c2c1nc[nH]2)Br)N |
| InChi: | InChI=1S/C7H6BrN3/c8-5-1-4(9)2-6-7(5)11-3-10-6/h1-3H,9H2,(H,10,11) |
| InChiKey: | InChIKey=POIDKQCFNHFVFV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.