Molecular Structure:
CAS No.:
177962-82-2
Product Name.:
CCD No.:CCD07395701
Formula:C27 H44 O
MolWeight:384.644
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 8(14)-DEHYDROCHOLESTEROL |
| CAS： | 177962-82-2 |
| English Synonyms： | CHOLESTA-5,8(14)-DIEN-3SS-OL ; CHOLESTA-5,8(14)-DIEN-3SS-OL ; CHOLESTA-5,8(14)-DIEN-3BETA-OL ; 8(14)-DEHYDROCHOLESTEROL ; CHOLESTA-5,8(14)-DIEN-3SS-OL |
| MDL Number.： | MFCD22416735 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | CC(C)CCC[C@@H](C)[C@H]1CCC2=C3CC=C4C[C@H](CC[C@@]4([C@H]3CC[C@]12C)C)O |
| InChi： | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21,23,25,28H,6-8,10-17H2,1-5H3/t19-,21+,23-,25+,26+,27-/m1/s1 |
| InChiKey： | InChIKey=DJNCIOAUQVURTQ-RQZUOROGSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
