* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-AMINO-4(5H)-OXAZOLONE |
| CAS: | 17816-85-2 |
| English Synonyms: | 4(5H)-OXAZOLONE, 2-AMINO- ; 2-AMINO-4,5-DIHYDRO-1,3-OXAZOL-4-ONE ; 2-AMINO-4(5H)-OXAZOLONE ; 2-AMINOOXAZOL-4(5H)-ONE |
| MDL Number.: | MFCD00807941 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C1C(=O)N=C(O1)N |
| InChi: | InChI=1S/C3H4N2O2/c4-3-5-2(6)1-7-3/h1H2,(H2,4,5,6) |
| InChiKey: | InChIKey=KVUPQEKUVSNRCD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.