* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-Norvaline, 5-azido-, hydrochloride (1:1) |
CAS: | 1782935-10-7 |
English Synonyms: | L-NORVALINE, 5-AZIDO-, HYDROCHLORIDE (1:1) |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.N(=[N+]=[N-])CCC[C@H](N)C(=O)O |
InChi: | InChI=1S/C5H10N4O2.ClH/c6-4(5(10)11)2-1-3-8-9-7;/h4H,1-3,6H2,(H,10,11);1H/t4-;/m0./s1 |
InChiKey: | InChIKey=HBDWAEAKFVAPSA-WCCKRBBISA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.