* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzoic acid, 2-hydroxy-3-(methylamino)- |
CAS: | 17839-49-5 |
English Synonyms: | BENZOIC ACID, 2-HYDROXY-3-(METHYLAMINO)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OC1=C(C(=O)O)C=CC=C1NC |
InChi: | InChI=1S/C8H9NO3/c1-9-6-4-2-3-5(7(6)10)8(11)12/h2-4,9-10H,1H3,(H,11,12) |
InChiKey: | InChIKey=DOSVKTQBDPDMJF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.