* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | MG-262 |
| CAS: | 179324-22-2 |
| English Synonyms: | MG-262 ; Z-LEU-LEU-LEU-B(OH)2 ; PROTEASOME INHIBITOR III ; Z-LLL-B(OH)2 |
| MDL Number.: | MFCD02179373 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | B(C(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)(O)O |
| InChi: | InChI=1S/C26H42BN3O7/c1-16(2)12-20(23(31)27(35)36)28-24(32)21(13-17(3)4)29-25(33)22(14-18(5)6)30-26(34)37-15-19-10-8-7-9-11-19/h7-11,16-18,20-22,35-36H,12-15H2,1-6H3,(H,28,32)(H,29,33)(H,30,34)/t20-,21-,22-/m0/s1 |
| InChiKey: | InChIKey=GPWIPTHHAKFKLH-FKBYEOEOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.