* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Oxazolidinone, 3-(1-oxooctyl)-4-phenyl-, (R)- (9CI) |
CAS: | 179681-08-4 |
English Synonyms: | 2-OXAZOLIDINONE, 3-(1-OXOOCTYL)-4-PHENYL-, (R)- (9CI) |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O=C(CCCCCCC)N1C(OC[C@H]1C1=CC=CC=C1)=O |
InChi: | InChI=1S/C17H23NO3/c1-2-3-4-5-9-12-16(19)18-15(13-21-17(18)20)14-10-7-6-8-11-14/h6-8,10-11,15H,2-5,9,12-13H2,1H3/t15-/m0/s1 |
InChiKey: | InChIKey=HAVAANCCHNYXIW-HNNXBMFYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.