* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHENYL(1-PHENYL-1H-1,2,4-TRIAZOL-3-YL)METHANONE |
| CAS: | 18011-20-6 |
| English Synonyms: | PHENYL(1-PHENYL-1H-1,2,4-TRIAZOL-3-YL)METHANONE |
| MDL Number.: | MFCD01104460 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)C(=O)c2ncn(n2)c3ccccc3 |
| InChi: | InChI=1S/C15H11N3O/c19-14(12-7-3-1-4-8-12)15-16-11-18(17-15)13-9-5-2-6-10-13/h1-11H |
| InChiKey: | InChIKey=MYEARXDRWUCMCM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.