* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-Ethoxy-3-methylazetidine HCl |
CAS: | 1807872-03-2 |
English Synonyms: | 3-ETHOXY-3-METHYLAZETIDINE HCL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.C(C)OC1(CNC1)C |
InChi: | InChI=1S/C6H13NO.ClH/c1-3-8-6(2)4-7-5-6;/h7H,3-5H2,1-2H3;1H |
InChiKey: | InChIKey=CSZSLKOMLADLFF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.