* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Fmoc-7-methyl-L-tryptophan |
CAS: | 1808268-53-2 |
English Synonyms: | N-FMOC-7-METHYL-L-TRYPTOPHAN |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N[C@@H](CC1=CNC2=C(C=CC=C12)C)C(=O)O |
InChi: | InChI=1S/C27H24N2O4/c1-16-7-6-12-18-17(14-28-25(16)18)13-24(26(30)31)29-27(32)33-15-23-21-10-4-2-8-19(21)20-9-3-5-11-22(20)23/h2-12,14,23-24,28H,13,15H2,1H3,(H,29,32)(H,30,31)/t24-/m0/s1 |
InChiKey: | InChIKey=LIHWPPTURGLCAT-DEOSSOPVSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.