* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-BUTYL-1,2,3-TRIHYDROXY BENZENE |
CAS: | 180911-04-0 |
English Synonyms: | 5-BUTYL-1,2,3-TRIHYDROXY BENZENE ; 5-BUTYLBENZENE-1,2,3-TRIOL |
MDL Number.: | MFCD16875961 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | CCCCc1cc(c(c(c1)O)O)O |
InChi: | InChI=1S/C10H14O3/c1-2-3-4-7-5-8(11)10(13)9(12)6-7/h5-6,11-13H,2-4H2,1H3 |
InChiKey: | InChIKey=IYYQMHXKCORAJN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.