* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LASOFOXIFENE |
| CAS: | 180915-85-9 ;180916-16-9 |
| English Synonyms: | LASOFOXIFENE |
| MDL Number.: | MFCD09475650 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)[C@H]2CCc3cc(ccc3[C@H]2c4ccc(cc4)OCCN5CCCC5)O |
| InChi: | InChI=1S/C28H31NO2/c30-24-11-15-27-23(20-24)10-14-26(21-6-2-1-3-7-21)28(27)22-8-12-25(13-9-22)31-19-18-29-16-4-5-17-29/h1-3,6-9,11-13,15,20,26,28,30H,4-5,10,14,16-19H2/t26-,28+/m1/s1 |
| InChiKey: | InChIKey=GXESHMAMLJKROZ-IAPPQJPRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.