* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2H-Isoindole-2-acetic acid, 1,3-dihydro-α-(1-methylethyl)-1-oxo-, (αS)- |
CAS: | 180923-77-7 |
English Synonyms: | 2H-ISOINDOLE-2-ACETIC ACID, 1,3-DIHYDRO-Α-(1-METHYLETHYL)-1-OXO-, (ΑS)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(C)[C@@H](C(=O)O)N1C(C2=CC=CC=C2C1)=O |
InChi: | InChI=1S/C13H15NO3/c1-8(2)11(13(16)17)14-7-9-5-3-4-6-10(9)12(14)15/h3-6,8,11H,7H2,1-2H3,(H,16,17)/t11-/m0/s1 |
InChiKey: | InChIKey=JULAETYRRYJIAR-NSHDSACASA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.