* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,3,5-TRIAZINE-2,4-DIAMINE, 6-(2-PYRAZINYL)- |
| CAS: | 18106-97-3 |
| English Synonyms: | 6-(PYRAZIN-2-YL)-1,3,5-TRIAZINE-2,4-DIAMINE ; 1,3,5-TRIAZINE-2,4-DIAMINE, 6-(2-PYRAZINYL)- |
| MDL Number.: | MFCD01678997 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1cnc(cn1)c2nc(nc(n2)N)N |
| InChi: | InChI=1S/C7H7N7/c8-6-12-5(13-7(9)14-6)4-3-10-1-2-11-4/h1-3H,(H4,8,9,12,13,14) |
| InChiKey: | InChIKey=NBTPDJCUHITSDX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.