* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzene, 4-(4-bromobutyl)-1,2-difluoro- |
CAS: | 181805-55-0 |
English Synonyms: | BENZENE, 4-(4-BROMOBUTYL)-1,2-DIFLUORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrCCCCC1=CC(=C(C=C1)F)F |
InChi: | InChI=1S/C10H11BrF2/c11-6-2-1-3-8-4-5-9(12)10(13)7-8/h4-5,7H,1-3,6H2 |
InChiKey: | InChIKey=QUQFSSPDIPPXLH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.