* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (S)-4-(tert-butoxy)-2-methyl-4-oxobutanoic acid |
CAS: | 182007-75-6 |
English Synonyms: | (S)-4-(TERT-BUTOXY)-2-METHYL-4-OXOBUTANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)(C)(C)OC(C[C@@H](C(=O)O)C)=O |
InChi: | InChI=1S/C9H16O4/c1-6(8(11)12)5-7(10)13-9(2,3)4/h6H,5H2,1-4H3,(H,11,12)/t6-/m0/s1 |
InChiKey: | InChIKey=RSLMNCHJSYDERN-LURJTMIESA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.