* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (4R)-4-(Boc-amino)-1-Fmoc-D-proline |
CAS: | 1820574-93-3 |
English Synonyms: | (4R)-4-(BOC-AMINO)-1-FMOC-D-PROLINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N[C@@H]1C[C@@H](N(C1)C(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C(=O)O |
InChi: | InChI=1S/C25H28N2O6/c1-25(2,3)33-23(30)26-15-12-21(22(28)29)27(13-15)24(31)32-14-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-11,15,20-21H,12-14H2,1-3H3,(H,26,30)(H,28,29)/t15-,21-/m1/s1 |
InChiKey: | InChIKey=FJEXPICLVWOJSE-QVKFZJNVSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.