* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Oxazolidinone, 4-phenyl-3-(2-phenylacetyl)- |
CAS: | 1821075-30-2 |
English Synonyms: | 2-OXAZOLIDINONE, 4-PHENYL-3-(2-PHENYLACETYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC=C1)C1N(C(OC1)=O)C(CC1=CC=CC=C1)=O |
InChi: | InChI=1S/C17H15NO3/c19-16(11-13-7-3-1-4-8-13)18-15(12-21-17(18)20)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
InChiKey: | InChIKey=JFXXIVSAIDMXNC-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.