* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2R)-2-(Fmoc-amino)undecanoic acid |
CAS: | 1821771-29-2 |
English Synonyms: | (2R)-2-(FMOC-AMINO)UNDECANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N[C@@H](C(=O)O)CCCCCCCCC |
InChi: | InChI=1S/C26H33NO4/c1-2-3-4-5-6-7-8-17-24(25(28)29)27-26(30)31-18-23-21-15-11-9-13-19(21)20-14-10-12-16-22(20)23/h9-16,23-24H,2-8,17-18H2,1H3,(H,27,30)(H,28,29)/t24-/m1/s1 |
InChiKey: | InChIKey=IGRGFQSURTWTSB-XMMPIXPASA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.