* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2R)-2-(Fmoc-amino)dodecanoic acid |
CAS: | 1821832-97-6 |
English Synonyms: | (2R)-2-(FMOC-AMINO)DODECANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N[C@@H](C(=O)O)CCCCCCCCCC |
InChi: | InChI=1S/C27H35NO4/c1-2-3-4-5-6-7-8-9-18-25(26(29)30)28-27(31)32-19-24-22-16-12-10-14-20(22)21-15-11-13-17-23(21)24/h10-17,24-25H,2-9,18-19H2,1H3,(H,28,31)(H,29,30)/t25-/m1/s1 |
InChiKey: | InChIKey=ZKMKLCPVASBFKI-RUZDIDTESA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.