* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-PYRROLIDINOL, 1-(2-PROPYNYL)-, (3S)- |
CAS: | 182198-17-0 |
English Synonyms: | 3-PYRROLIDINOL, 1-(2-PROPYNYL)-, (3S)- |
MDL Number.: | MFCD18829920 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C#CCN1CC[C@@H](C1)O |
InChi: | InChI=1S/C7H11NO/c1-2-4-8-5-3-7(9)6-8/h1,7,9H,3-6H2/t7-/m0/s1 |
InChiKey: | InChIKey=HNZAITVCMOWUMH-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.