* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DL-Norleucine, 6-(phenylmethoxy)- |
CAS: | 1822426-30-1 |
English Synonyms: | DL-NORLEUCINE, 6-(PHENYLMETHOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC=C1)COCCCCC(N)C(=O)O |
InChi: | InChI=1S/C13H19NO3/c14-12(13(15)16)8-4-5-9-17-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,14H2,(H,15,16) |
InChiKey: | InChIKey=RPGCAWCHHYWJIF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.