* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-TYROSINE,2,3-DIFLUORO- |
| CAS: | 182756-49-6 |
| English Synonyms: | L-TYROSINE,2,3-DIFLUORO- |
| MDL Number.: | MFCD17019198 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1cc(c(c(c1C[C@@H](C(=O)O)N)F)F)O |
| InChi: | InChI=1S/C9H9F2NO3/c10-7-4(3-5(12)9(14)15)1-2-6(13)8(7)11/h1-2,5,13H,3,12H2,(H,14,15)/t5-/m0/s1 |
| InChiKey: | InChIKey=XWNMQLVJIYFCFZ-YFKPBYRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.