* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3,6-TRINITROTOLUENE |
CAS: | 18292-97-2 |
English Synonyms: | 2,3,6-TRINITROTOLUENE |
MDL Number.: | MFCD01679612 |
H bond acceptor: | 9 |
H bond donor: | 0 |
Smile: | Cc1c(ccc(c1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
InChi: | InChI=1S/C7H5N3O6/c1-4-5(8(11)12)2-3-6(9(13)14)7(4)10(15)16/h2-3H,1H3 |
InChiKey: | InChIKey=LFCALAUEQXYQIV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.