* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISO DESLORATADINE |
| CAS: | 183198-49-4 |
| English Synonyms: | ISO DESLORATADINE |
| MDL Number.: | MFCD09840813 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2c(nc1)C(c3ccc(cc3CC2)Cl)C4=CCNCC4 |
| InChi: | InChI=1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-7,9,12,18,21H,3-4,8,10-11H2 |
| InChiKey: | InChIKey=ADSCCBORDDPTRQ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.