* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL-2-(2-ALLYL)-4-PENTENOTATE |
CAS: | 18325-74-1 |
English Synonyms: | ETHYL 2-(PROP-2-EN-1-YL)PENT-4-ENOATE ; ETHYL-2-(2-ALLYL)-4-PENTENOTATE |
MDL Number.: | MFCD03265469 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCOC(=O)C(CC=C)CC=C |
InChi: | InChI=1S/C10H16O2/c1-4-7-9(8-5-2)10(11)12-6-3/h4-5,9H,1-2,6-8H2,3H3 |
InChiKey: | InChIKey=UJPKJTLFVKISHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.