* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GANTOFIBAN |
CAS: | 183547-57-1 |
English Synonyms: | GANTOFIBAN |
MDL Number.: | MFCD00951275 |
H bond acceptor: | 11 |
H bond donor: | 2 |
Smile: | CCOC(=O)CN1CCN(CC1)C[C@@H]2CN(C(=O)O2)c3ccc(cc3)C(=N)NC(=O)OC |
InChi: | InChI=1S/C21H29N5O6/c1-3-31-18(27)14-25-10-8-24(9-11-25)12-17-13-26(21(29)32-17)16-6-4-15(5-7-16)19(22)23-20(28)30-2/h4-7,17H,3,8-14H2,1-2H3,(H2,22,23,28)/t17-/m1/s1 |
InChiKey: | InChIKey=YNBHAPKHWDNTMZ-QGZVFWFLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.