* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3-DIHYDRO-1H-PYRROLIZIN-1-OL |
| CAS: | 18377-79-2 |
| English Synonyms: | 2,3-DIHYDRO-1H-PYRROLIZIN-1-OL |
| MDL Number.: | MFCD01687123 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2n(c1)CCC2O |
| InChi: | InChI=1S/C7H9NO/c9-7-3-5-8-4-1-2-6(7)8/h1-2,4,7,9H,3,5H2 |
| InChiKey: | InChIKey=GJPIBIKCYIRYTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.