* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,4'''-BIS[(2-BUTYLOCTYL)OXY]-1,1':4',1'':4'',1'''-QUATERPHENYL |
CAS: | 18434-08-7 |
English Synonyms: | 4,4'''-BIS[(2-BUTYLOCTYL)OXY]-1,1':4',1'':4'',1'''-QUATERPHENYL ; 4,4'''-BIS-(2-BUTYL-OCTYLOXY)-(1,1',4',1'',4'',1''')QUATERPHENYL |
MDL Number.: | MFCD02667784 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCCCCC(CCCC)COc1ccc(cc1)c2ccc(cc2)c3ccc(cc3)c4ccc(cc4)OCC(CCCC)CCCCCC |
InChi: | InChI=1S/C48H66O2/c1-5-9-13-15-19-39(17-11-7-3)37-49-47-33-29-45(30-34-47)43-25-21-41(22-26-43)42-23-27-44(28-24-42)46-31-35-48(36-32-46)50-38-40(18-12-8-4)20-16-14-10-6-2/h21-36,39-40H,5-20,37-38H2,1-4H3 |
InChiKey: | InChIKey=JMLYWQXLJYRYHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.