* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PYRIDO[2,3-B][1,4]THIAZIN-2(3H)-ONE |
CAS: | 18504-81-9 |
English Synonyms: | 1H-PYRIDO[2,3-B][1,4]THIAZIN-2-ONE ; 1H,2H,3H-PYRIDO[2,3-B][1,4]THIAZIN-2-ONE ; 1H-PYRIDO[2,3-B][1,4]THIAZIN-2(3H)-ONE |
MDL Number.: | MFCD01689989 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c(nc1)SCC(=O)N2 |
InChi: | InChI=1S/C7H6N2OS/c10-6-4-11-7-5(9-6)2-1-3-8-7/h1-3H,4H2,(H,9,10) |
InChiKey: | InChIKey=BOASKSPVGGTZKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.